C16H30O3 — CID 79425693
4-tert-butyl-1-(5-hydroxypentyl)cyclohexane-1-carboxylic acid (PubChem CID 79425693) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 4-tert-butyl-1-(5-hydroxypentyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-1-(5-hydroxypentyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79425693 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 4-tert-butyl-1-(5-hydroxypentyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)C1CCC(CCCCCO)(C(=O)O)CC1 |
| InChI | InChI=1S/C16H30O3/c1-15(2,3)13-7-10-16(11-8-13,14(18)19)9-5-4-6-12-17/h13,17H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | IKXILOAVZKXRHF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|