4-(5-hydroxypentyl)piperidine-4-carboxylic acid

C11H21NO3 — CID 79424853

IUPAC4-(5-hydroxypentyl)piperidine-4-carboxylic acid
SMILESO=C(O)C1(CCCCCO)CCNCC1
InChIInChI=1S/C11H21NO3/c13-9-3-1-2-4-11(10(14)15)5-7-12-8-6-11/h12-13H,1-9H2,(H,14,15)
InChIKeyMJFAYRFSEIEACO-UHFFFAOYSA-N
MW215.29 g/mol
LogP0.99
Rot. Bonds6

About 4-(5-hydroxypentyl)piperidine-4-carboxylic acid

4-(5-hydroxypentyl)piperidine-4-carboxylic acid (PubChem CID 79424853) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-(5-hydroxypentyl)piperidine-4-carboxylic acid.

Molecular Properties

Compound Name4-(5-hydroxypentyl)piperidine-4-carboxylic acid
PubChem CID79424853
Molecular FormulaC11H21NO3
Molecular Weight215.29 g/mol
Exact Mass215.15
IUPAC Name4-(5-hydroxypentyl)piperidine-4-carboxylic acid
SMILESO=C(O)C1(CCCCCO)CCNCC1
InChIInChI=1S/C11H21NO3/c13-9-3-1-2-4-11(10(14)15)5-7-12-8-6-11/h12-13H,1-9H2,(H,14,15)
InChIKeyMJFAYRFSEIEACO-UHFFFAOYSA-N
XLogP0.99
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.29
LogP ≤ 50.99
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(5-hydroxypentyl)piperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(6-hydroxyhexyl)piperidine-3-carboxylic acid
CID 107704736
1-(4-hydroxybutyl)-4,4-dimethylcyclohexane-1-carboxylic acid
CID 79428551
4-(6-hydroxyhexyl)-1,1-dioxothiane-4-carboxylic acid
CID 146658372
3-hexylpyrrolidine-3-carboxylic acid
CID 63140617
1-acetyl-4-(7-hydroxyheptyl)piperidine-4-carboxylic acid
CID 146658373
1-[5-(1-carboxycyclopentyl)pentyl]cyclopentane-1-carboxylic acid
CID 54469920
1-nonylcyclopropane-1-carboxylic acid
CID 54124337
1-(10,10,10-trifluorodecyl)cyclopropane-1-carboxylic acid
CID 150208157
4-tert-butyl-1-(5-hydroxypentyl)cyclohexane-1-carboxylic acid
CID 79425693
1-[5-(1-carboxycyclohexyl)pentyl]cyclohexane-1-carboxylic acid
CID 19090977
1-[12-(1-aminocyclopropyl)dodecyl]cyclopropane-1-carboxylic acid
CID 66828639
1-[4-(2-hydroxyethoxy)butyl]cyclopropane-1-carboxylic acid
CID 70523379

Frequently Asked Questions

What is the IUPAC name of 4-(5-hydroxypentyl)piperidine-4-carboxylic acid?
The IUPAC name of 4-(5-hydroxypentyl)piperidine-4-carboxylic acid (CID 79424853) is 4-(5-hydroxypentyl)piperidine-4-carboxylic acid.
What is the SMILES notation for 4-(5-hydroxypentyl)piperidine-4-carboxylic acid?
The canonical SMILES for 4-(5-hydroxypentyl)piperidine-4-carboxylic acid is O=C(O)C1(CCCCCO)CCNCC1.
What is the InChIKey of 4-(5-hydroxypentyl)piperidine-4-carboxylic acid?
The InChIKey is MJFAYRFSEIEACO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c13-9-3-1-2-4-11(10(14)15)5-7-12-8-6-11/h12-13H,1-9H2,(H,14,15).
What are the key properties of 4-(5-hydroxypentyl)piperidine-4-carboxylic acid?
4-(5-hydroxypentyl)piperidine-4-carboxylic acid has a molecular weight of 215.29 g/mol, XLogP of 0.99, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-hydroxypentyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 79424853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).