C12H22O5S — CID 146658372
4-(6-hydroxyhexyl)-1,1-dioxothiane-4-carboxylic acid (PubChem CID 146658372) has the molecular formula C12H22O5S and a molecular weight of 278.37 g/mol. Its IUPAC name is 4-(6-hydroxyhexyl)-1,1-dioxothiane-4-carboxylic acid.
| Compound Name | 4-(6-hydroxyhexyl)-1,1-dioxothiane-4-carboxylic acid |
|---|---|
| PubChem CID | 146658372 |
| Molecular Formula | C12H22O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-(6-hydroxyhexyl)-1,1-dioxothiane-4-carboxylic acid |
| SMILES | O=C(O)C1(CCCCCCO)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H22O5S/c13-8-4-2-1-3-5-12(11(14)15)6-9-18(16,17)10-7-12/h13H,1-10H2,(H,14,15) |
| InChIKey | MEWKCTCFGHMPIP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|