C14H23F3O2 — CID 150208157
1-(10,10,10-trifluorodecyl)cyclopropane-1-carboxylic acid (PubChem CID 150208157) has the molecular formula C14H23F3O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(10,10,10-trifluorodecyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(10,10,10-trifluorodecyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 150208157 |
| Molecular Formula | C14H23F3O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-(10,10,10-trifluorodecyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(CCCCCCCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H23F3O2/c15-14(16,17)9-7-5-3-1-2-4-6-8-13(10-11-13)12(18)19/h1-11H2,(H,18,19) |
| InChIKey | FQXIWHZAPMHWAH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|