C15H28O3 — CID 79425798
4-tert-butyl-1-(2-hydroxy-2-methylpropyl)cyclohexane-1-carboxylic acid (PubChem CID 79425798) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-tert-butyl-1-(2-hydroxy-2-methylpropyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-1-(2-hydroxy-2-methylpropyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79425798 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 4-tert-butyl-1-(2-hydroxy-2-methylpropyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(O)CC1(C(=O)O)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28O3/c1-13(2,3)11-6-8-15(9-7-11,12(16)17)10-14(4,5)18/h11,18H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | SHTDQNYDRGYPKF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |