C7H9NO4 — CID 167715833
methyl 2-(methoxycarbonylamino)but-3-ynoate (PubChem CID 167715833) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is methyl 2-(methoxycarbonylamino)but-3-ynoate.
| Compound Name | methyl 2-(methoxycarbonylamino)but-3-ynoate |
|---|---|
| PubChem CID | 167715833 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | methyl 2-(methoxycarbonylamino)but-3-ynoate |
| SMILES | C#CC(NC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C7H9NO4/c1-4-5(6(9)11-2)8-7(10)12-3/h1,5H,2-3H3,(H,8,10) |
| InChIKey | KLRODVUPGSFGPF-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|