2-amino-2-(methoxycarbonylamino)acetic acid

C4H8N2O4 — CID 129058062

IUPAC2-amino-2-(methoxycarbonylamino)acetic acid
SMILESCOC(=O)NC(N)C(=O)O
InChIInChI=1S/C4H8N2O4/c1-10-4(9)6-2(5)3(7)8/h2H,5H2,1H3,(H,6,9)(H,7,8)
InChIKeyBMDDWSKTSMPVGT-UHFFFAOYSA-N
MW148.12 g/mol
LogP-1.29
Rot. Bonds2

About 2-amino-2-(methoxycarbonylamino)acetic acid

2-amino-2-(methoxycarbonylamino)acetic acid (PubChem CID 129058062) has the molecular formula C4H8N2O4 and a molecular weight of 148.12 g/mol. Its IUPAC name is 2-amino-2-(methoxycarbonylamino)acetic acid.

Molecular Properties

Compound Name2-amino-2-(methoxycarbonylamino)acetic acid
PubChem CID129058062
Molecular FormulaC4H8N2O4
Molecular Weight148.12 g/mol
Exact Mass148.05
IUPAC Name2-amino-2-(methoxycarbonylamino)acetic acid
SMILESCOC(=O)NC(N)C(=O)O
InChIInChI=1S/C4H8N2O4/c1-10-4(9)6-2(5)3(7)8/h2H,5H2,1H3,(H,6,9)(H,7,8)
InChIKeyBMDDWSKTSMPVGT-UHFFFAOYSA-N
XLogP-1.29
TPSA101.65 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.12
LogP ≤ 5-1.29
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-amino-2-(methoxycarbonylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(methoxycarbonylamino)acetic acid?
The IUPAC name of 2-amino-2-(methoxycarbonylamino)acetic acid (CID 129058062) is 2-amino-2-(methoxycarbonylamino)acetic acid.
What is the SMILES notation for 2-amino-2-(methoxycarbonylamino)acetic acid?
The canonical SMILES for 2-amino-2-(methoxycarbonylamino)acetic acid is COC(=O)NC(N)C(=O)O.
What is the InChIKey of 2-amino-2-(methoxycarbonylamino)acetic acid?
The InChIKey is BMDDWSKTSMPVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O4/c1-10-4(9)6-2(5)3(7)8/h2H,5H2,1H3,(H,6,9)(H,7,8).
What are the key properties of 2-amino-2-(methoxycarbonylamino)acetic acid?
2-amino-2-(methoxycarbonylamino)acetic acid has a molecular weight of 148.12 g/mol, XLogP of -1.29, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(methoxycarbonylamino)acetic acid is sourced from PubChem (CID 129058062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).