C8H19N3O4 — CID 86656444
hydrazine;(2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid (PubChem CID 86656444) has the molecular formula C8H19N3O4 and a molecular weight of 221.26 g/mol. Its IUPAC name is hydrazine;(2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid.
| Compound Name | hydrazine;(2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 86656444 |
| Molecular Formula | C8H19N3O4 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | hydrazine;(2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid |
| SMILES | COC(=O)N[C@H](C(=O)O)C(C)(C)C.NN |
| InChI | InChI=1S/C8H15NO4.H4N2/c1-8(2,3)5(6(10)11)9-7(12)13-4;1-2/h5H,1-4H3,(H,9,12)(H,10,11);1-2H2/t5-;/m1./s1 |
| InChIKey | XMYGFVNQLNTTDB-NUBCRITNSA-N |
| XLogP | -0.34 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|