C10H19NO3 — CID 61143223
(2S)-3,3-dimethyl-2-(2-methylpropanoylamino)butanoic acid (PubChem CID 61143223) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(2-methylpropanoylamino)butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-(2-methylpropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 61143223 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(2-methylpropanoylamino)butanoic acid |
| SMILES | CC(C)C(=O)N[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H19NO3/c1-6(2)8(12)11-7(9(13)14)10(3,4)5/h6-7H,1-5H3,(H,11,12)(H,13,14)/t7-/m1/s1 |
| InChIKey | UTFGFEOWXFAMFJ-SSDOTTSWSA-N |
| XLogP | 1.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |