(2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid

C12H23NO3 — CID 61143229

IUPAC(2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid
SMILESCCC(CC)C(=O)N[C@H](C(=O)O)C(C)(C)C
InChIInChI=1S/C12H23NO3/c1-6-8(7-2)10(14)13-9(11(15)16)12(3,4)5/h8-9H,6-7H2,1-5H3,(H,13,14)(H,15,16)/t9-/m1/s1
InChIKeyAPSSCCSRCMRIJY-SECBINFHSA-N
MW229.32 g/mol
LogP2.04
Rot. Bonds5

About (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid

(2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid (PubChem CID 61143229) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name(2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid
PubChem CID61143229
Molecular FormulaC12H23NO3
Molecular Weight229.32 g/mol
Exact Mass229.17
IUPAC Name(2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid
SMILESCCC(CC)C(=O)N[C@H](C(=O)O)C(C)(C)C
InChIInChI=1S/C12H23NO3/c1-6-8(7-2)10(14)13-9(11(15)16)12(3,4)5/h8-9H,6-7H2,1-5H3,(H,13,14)(H,15,16)/t9-/m1/s1
InChIKeyAPSSCCSRCMRIJY-SECBINFHSA-N
XLogP2.04
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 52.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid?
The IUPAC name of (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid (CID 61143229) is (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid.
What is the SMILES notation for (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid?
The canonical SMILES for (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid is CCC(CC)C(=O)N[C@H](C(=O)O)C(C)(C)C.
What is the InChIKey of (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid?
The InChIKey is APSSCCSRCMRIJY-SECBINFHSA-N. The full InChI is InChI=1S/C12H23NO3/c1-6-8(7-2)10(14)13-9(11(15)16)12(3,4)5/h8-9H,6-7H2,1-5H3,(H,13,14)(H,15,16)/t9-/m1/s1.
What are the key properties of (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid?
(2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid has a molecular weight of 229.32 g/mol, XLogP of 2.04, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2-ethylbutanoylamino)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 61143229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).