C12H24N2O3 — CID 61161199
2-(2-aminohexanoylamino)-3,3-dimethylbutanoic acid (PubChem CID 61161199) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-(2-aminohexanoylamino)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(2-aminohexanoylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 61161199 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-(2-aminohexanoylamino)-3,3-dimethylbutanoic acid |
| SMILES | CCCCC(N)C(=O)NC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O3/c1-5-6-7-8(13)10(15)14-9(11(16)17)12(2,3)4/h8-9H,5-7,13H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | WJGWSXXERKYZJJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |