C10H21NO — CID 153456545
N-[(2S)-3,3-dimethylbutan-2-yl]-2-methylpropanamide (PubChem CID 153456545) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethylbutan-2-yl]-2-methylpropanamide.
| Compound Name | N-[(2S)-3,3-dimethylbutan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 153456545 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N-[(2S)-3,3-dimethylbutan-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C10H21NO/c1-7(2)9(12)11-8(3)10(4,5)6/h7-8H,1-6H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | PCNLPZCALHDOFJ-QMMMGPOBSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |