About 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide
2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide (PubChem CID 175635601) has the molecular formula C9H16F3NO
and a molecular weight of 211.23 g/mol. Its IUPAC name is 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide |
| PubChem CID | 175635601 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide |
| SMILES | CC(C)C(=O)NC(C(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c1-5(2)7(9(10,11)12)13-8(14)6(3)4/h5-7H,1-4H3,(H,13,14) |
| InChIKey | NZIMTKGCJXCMCM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide?
The IUPAC name of 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide (CID 175635601) is 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide.
What is the SMILES notation for 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide?
The canonical SMILES for 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide is CC(C)C(=O)NC(C(C)C)C(F)(F)F.
What is the InChIKey of 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide?
The InChIKey is NZIMTKGCJXCMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO/c1-5(2)7(9(10,11)12)13-8(14)6(3)4/h5-7H,1-4H3,(H,13,14).
What are the key properties of 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide?
2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide has a molecular weight of 211.23 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)propanamide is sourced from PubChem (CID 175635601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).