C15H31NO — CID 90347352
2-methyl-N-(2,2,6,6-tetramethylheptan-3-yl)propanamide (PubChem CID 90347352) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-methyl-N-(2,2,6,6-tetramethylheptan-3-yl)propanamide.
| Compound Name | 2-methyl-N-(2,2,6,6-tetramethylheptan-3-yl)propanamide |
|---|---|
| PubChem CID | 90347352 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 2-methyl-N-(2,2,6,6-tetramethylheptan-3-yl)propanamide |
| SMILES | CC(C)C(=O)NC(CCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H31NO/c1-11(2)13(17)16-12(15(6,7)8)9-10-14(3,4)5/h11-12H,9-10H2,1-8H3,(H,16,17) |
| InChIKey | WJIDJYOGRKBOMR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |