C15H30ClNO — CID 106355550
N-(1-chloro-4,4-dimethylpentan-3-yl)-2-propylpentanamide (PubChem CID 106355550) has the molecular formula C15H30ClNO and a molecular weight of 275.86 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-2-propylpentanamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-2-propylpentanamide |
|---|---|
| PubChem CID | 106355550 |
| Molecular Formula | C15H30ClNO |
| Molecular Weight | 275.86 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)NC(CCCl)C(C)(C)C |
| InChI | InChI=1S/C15H30ClNO/c1-6-8-12(9-7-2)14(18)17-13(10-11-16)15(3,4)5/h12-13H,6-11H2,1-5H3,(H,17,18) |
| InChIKey | YUKLNCJKBKTLGC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|