C15H32N2O — CID 114178195
N-(1-amino-4,4-dimethylpentan-3-yl)-2-ethylhexanamide (PubChem CID 114178195) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is N-(1-amino-4,4-dimethylpentan-3-yl)-2-ethylhexanamide.
| Compound Name | N-(1-amino-4,4-dimethylpentan-3-yl)-2-ethylhexanamide |
|---|---|
| PubChem CID | 114178195 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | N-(1-amino-4,4-dimethylpentan-3-yl)-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)NC(CCN)C(C)(C)C |
| InChI | InChI=1S/C15H32N2O/c1-6-8-9-12(7-2)14(18)17-13(10-11-16)15(3,4)5/h12-13H,6-11,16H2,1-5H3,(H,17,18) |
| InChIKey | VFZYPPNUTMFSSU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |