C14H29NO — CID 58709489
N-(3,3-dimethylbutan-2-yl)-2-ethylhexanamide (PubChem CID 58709489) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2-ethylhexanamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2-ethylhexanamide |
|---|---|
| PubChem CID | 58709489 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)NC(C)C(C)(C)C |
| InChI | InChI=1S/C14H29NO/c1-7-9-10-12(8-2)13(16)15-11(3)14(4,5)6/h11-12H,7-10H2,1-6H3,(H,15,16) |
| InChIKey | NYQCTXKGMSBQQU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |