C15H28F3NO — CID 90347365
3,3,3-trifluoro-N-(2,2,7,7-tetramethyloctan-3-yl)propanamide (PubChem CID 90347365) has the molecular formula C15H28F3NO and a molecular weight of 295.39 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(2,2,7,7-tetramethyloctan-3-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(2,2,7,7-tetramethyloctan-3-yl)propanamide |
|---|---|
| PubChem CID | 90347365 |
| Molecular Formula | C15H28F3NO |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 3,3,3-trifluoro-N-(2,2,7,7-tetramethyloctan-3-yl)propanamide |
| SMILES | CC(C)(C)CCCC(NC(=O)CC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C15H28F3NO/c1-13(2,3)9-7-8-11(14(4,5)6)19-12(20)10-15(16,17)18/h11H,7-10H2,1-6H3,(H,19,20) |
| InChIKey | WYSSYXLPSRHLGD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |