C12H26N2O2 — CID 106357033
N-(1-amino-4,4-dimethylpentan-3-yl)-4-methoxybutanamide (PubChem CID 106357033) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-(1-amino-4,4-dimethylpentan-3-yl)-4-methoxybutanamide.
| Compound Name | N-(1-amino-4,4-dimethylpentan-3-yl)-4-methoxybutanamide |
|---|---|
| PubChem CID | 106357033 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | N-(1-amino-4,4-dimethylpentan-3-yl)-4-methoxybutanamide |
| SMILES | COCCCC(=O)NC(CCN)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-12(2,3)10(7-8-13)14-11(15)6-5-9-16-4/h10H,5-9,13H2,1-4H3,(H,14,15) |
| InChIKey | UNNPPSQPLSYUSU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|