C24H48N2O4 — CID 164831434
N-[(3S)-7-[[2-(2-methoxyethoxy)acetyl]amino]-2,2-dimethylheptan-3-yl]-7,7-dimethyloctanamide (PubChem CID 164831434) has the molecular formula C24H48N2O4 and a molecular weight of 428.66 g/mol. Its IUPAC name is N-[(3S)-7-[[2-(2-methoxyethoxy)acetyl]amino]-2,2-dimethylheptan-3-yl]-7,7-dimethyloctanamide.
| Compound Name | N-[(3S)-7-[[2-(2-methoxyethoxy)acetyl]amino]-2,2-dimethylheptan-3-yl]-7,7-dimethyloctanamide |
|---|---|
| PubChem CID | 164831434 |
| Molecular Formula | C24H48N2O4 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.36 |
| IUPAC Name | N-[(3S)-7-[[2-(2-methoxyethoxy)acetyl]amino]-2,2-dimethylheptan-3-yl]-7,7-dimethyloctanamide |
| SMILES | COCCOCC(=O)NCCCC[C@H](NC(=O)CCCCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H48N2O4/c1-23(2,3)15-11-8-9-14-21(27)26-20(24(4,5)6)13-10-12-16-25-22(28)19-30-18-17-29-7/h20H,8-19H2,1-7H3,(H,25,28)(H,26,27)/t20-/m0/s1 |
| InChIKey | SHISYTRKASAOLH-FQEVSTJZSA-N |
| XLogP | 4.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|