C13H25NO4 — CID 113496760
3-(4-methoxybutanoylamino)-5,5-dimethylhexanoic acid (PubChem CID 113496760) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-(4-methoxybutanoylamino)-5,5-dimethylhexanoic acid.
| Compound Name | 3-(4-methoxybutanoylamino)-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 113496760 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 3-(4-methoxybutanoylamino)-5,5-dimethylhexanoic acid |
| SMILES | COCCCC(=O)NC(CC(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C13H25NO4/c1-13(2,3)9-10(8-12(16)17)14-11(15)6-5-7-18-4/h10H,5-9H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | LHLHDLUKQNMWDU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|