About 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid
3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid (PubChem CID 103019288) has the molecular formula C13H25NO4
and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid |
| PubChem CID | 103019288 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid |
| SMILES | COC(C)(C)C(=O)NC(CC(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C13H25NO4/c1-12(2,3)8-9(7-10(15)16)14-11(17)13(4,5)18-6/h9H,7-8H2,1-6H3,(H,14,17)(H,15,16) |
| InChIKey | QNULIHNLVZDTBN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid?
The IUPAC name of 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid (CID 103019288) is 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid.
What is the SMILES notation for 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid?
The canonical SMILES for 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid is COC(C)(C)C(=O)NC(CC(=O)O)CC(C)(C)C.
What is the InChIKey of 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid?
The InChIKey is QNULIHNLVZDTBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO4/c1-12(2,3)8-9(7-10(15)16)14-11(17)13(4,5)18-6/h9H,7-8H2,1-6H3,(H,14,17)(H,15,16).
What are the key properties of 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid?
3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid has a molecular weight of 259.35 g/mol, XLogP of 1.81, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methoxy-2-methylpropanoyl)amino]-5,5-dimethylhexanoic acid is sourced from PubChem (CID 103019288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).