C13H26N2O3 — CID 107570673
3-[[(2R)-2-aminopentanoyl]amino]-5,5-dimethylhexanoic acid (PubChem CID 107570673) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-[[(2R)-2-aminopentanoyl]amino]-5,5-dimethylhexanoic acid.
| Compound Name | 3-[[(2R)-2-aminopentanoyl]amino]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 107570673 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-[[(2R)-2-aminopentanoyl]amino]-5,5-dimethylhexanoic acid |
| SMILES | CCC[C@@H](N)C(=O)NC(CC(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-5-6-10(14)12(18)15-9(7-11(16)17)8-13(2,3)4/h9-10H,5-8,14H2,1-4H3,(H,15,18)(H,16,17)/t9?,10-/m1/s1 |
| InChIKey | CTHANMKGUZBXQR-QVDQXJPCSA-N |
| XLogP | 1.51 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |