C9H20N2O — CID 103794874
(2R)-2-amino-N-(3,3-dimethylbutan-2-yl)propanamide (PubChem CID 103794874) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is (2R)-2-amino-N-(3,3-dimethylbutan-2-yl)propanamide.
| Compound Name | (2R)-2-amino-N-(3,3-dimethylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 103794874 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (2R)-2-amino-N-(3,3-dimethylbutan-2-yl)propanamide |
| SMILES | CC(NC(=O)[C@@H](C)N)C(C)(C)C |
| InChI | InChI=1S/C9H20N2O/c1-6(10)8(12)11-7(2)9(3,4)5/h6-7H,10H2,1-5H3,(H,11,12)/t6-,7?/m1/s1 |
| InChIKey | LITDQNCVRIQZFS-ULUSZKPHSA-N |
| XLogP | 0.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |