3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid

C11H21NO3S — CID 43467677

IUPAC3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid
SMILESCC(C)SCC(=O)NC(C(=O)O)C(C)(C)C
InChIInChI=1S/C11H21NO3S/c1-7(2)16-6-8(13)12-9(10(14)15)11(3,4)5/h7,9H,6H2,1-5H3,(H,12,13)(H,14,15)
InChIKeyHLOYZUFUZPSGDZ-UHFFFAOYSA-N
MW247.36 g/mol
LogP1.74
Rot. Bonds5

About 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid

3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid (PubChem CID 43467677) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid.

Molecular Properties

Compound Name3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid
PubChem CID43467677
Molecular FormulaC11H21NO3S
Molecular Weight247.36 g/mol
Exact Mass247.12
IUPAC Name3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid
SMILESCC(C)SCC(=O)NC(C(=O)O)C(C)(C)C
InChIInChI=1S/C11H21NO3S/c1-7(2)16-6-8(13)12-9(10(14)15)11(3,4)5/h7,9H,6H2,1-5H3,(H,12,13)(H,14,15)
InChIKeyHLOYZUFUZPSGDZ-UHFFFAOYSA-N
XLogP1.74
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.36
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid?
The IUPAC name of 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid (CID 43467677) is 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid.
What is the SMILES notation for 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid?
The canonical SMILES for 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid is CC(C)SCC(=O)NC(C(=O)O)C(C)(C)C.
What is the InChIKey of 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid?
The InChIKey is HLOYZUFUZPSGDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3S/c1-7(2)16-6-8(13)12-9(10(14)15)11(3,4)5/h7,9H,6H2,1-5H3,(H,12,13)(H,14,15).
What are the key properties of 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid?
3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid has a molecular weight of 247.36 g/mol, XLogP of 1.74, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-[(2-propan-2-ylsulfanylacetyl)amino]butanoic acid is sourced from PubChem (CID 43467677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).