C9H17NO4 — CID 103926507
(2R)-2-[(2-methoxyacetyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 103926507) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2R)-2-[(2-methoxyacetyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(2-methoxyacetyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103926507 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (2R)-2-[(2-methoxyacetyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | COCC(=O)N[C@@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)7(8(12)13)10-6(11)5-14-4/h7H,5H2,1-4H3,(H,10,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | DTVCWYVDLVAPIG-ZETCQYMHSA-N |
| XLogP | 0.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |