C11H22N2O4 — CID 103156564
(2R)-2-[(4-amino-3-methoxybutanoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 103156564) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2R)-2-[(4-amino-3-methoxybutanoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(4-amino-3-methoxybutanoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103156564 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2R)-2-[(4-amino-3-methoxybutanoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | COC(CN)CC(=O)N[C@@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O4/c1-11(2,3)9(10(15)16)13-8(14)5-7(6-12)17-4/h7,9H,5-6,12H2,1-4H3,(H,13,14)(H,15,16)/t7?,9-/m0/s1 |
| InChIKey | WGRSTPRLQYWPNP-NETXQHHPSA-N |
| XLogP | -0.03 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |