C10H22N2O2 — CID 103154290
4-amino-3-methoxy-N-(3-methylbutan-2-yl)butanamide (PubChem CID 103154290) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(3-methylbutan-2-yl)butanamide.
| Compound Name | 4-amino-3-methoxy-N-(3-methylbutan-2-yl)butanamide |
|---|---|
| PubChem CID | 103154290 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 4-amino-3-methoxy-N-(3-methylbutan-2-yl)butanamide |
| SMILES | COC(CN)CC(=O)NC(C)C(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-7(2)8(3)12-10(13)5-9(6-11)14-4/h7-9H,5-6,11H2,1-4H3,(H,12,13) |
| InChIKey | NWVYEGIWZAREMO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |