C11H22N2O3 — CID 81086648
2-[(4-amino-3-methylbutanoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 81086648) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[(4-amino-3-methylbutanoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(4-amino-3-methylbutanoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 81086648 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-[(4-amino-3-methylbutanoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(CN)CC(=O)NC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-7(6-12)5-8(14)13-9(10(15)16)11(2,3)4/h7,9H,5-6,12H2,1-4H3,(H,13,14)(H,15,16) |
| InChIKey | OXLLGAKHUPUABD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |