About methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate
methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 88576811) has the molecular formula C8H16N2O3
and a molecular weight of 188.23 g/mol. Its IUPAC name is methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
Analyze methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate?
The IUPAC name of methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate (CID 88576811) is methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
What is the SMILES notation for methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate?
The canonical SMILES for methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate is COC(=O)N[C@@H](C(N)=O)C(C)(C)C.
What is the InChIKey of methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate?
The InChIKey is SKLDSZRPZGLODA-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H16N2O3/c1-8(2,3)5(6(9)11)10-7(12)13-4/h5H,1-4H3,(H2,9,11)(H,10,12)/t5-/m0/s1.
What are the key properties of methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate?
methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate has a molecular weight of 188.23 g/mol, XLogP of 0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2R)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]carbamate is sourced from PubChem (CID 88576811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).