C19H34N2O9 — CID 90435595
[3-methoxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl] 3-methoxy-2-(methoxycarbonylamino)-3-methylbutanoate (PubChem CID 90435595) has the molecular formula C19H34N2O9 and a molecular weight of 434.49 g/mol. Its IUPAC name is [3-methoxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl] 3-methoxy-2-(methoxycarbonylamino)-3-methylbutanoate.
| Compound Name | [3-methoxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl] 3-methoxy-2-(methoxycarbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 90435595 |
| Molecular Formula | C19H34N2O9 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [3-methoxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl] 3-methoxy-2-(methoxycarbonylamino)-3-methylbutanoate |
| SMILES | COC(=O)NC(C(=O)OC(=O)C(NC(=O)OC(C)(C)C)C(C)(C)OC)C(C)(C)OC |
| InChI | InChI=1S/C19H34N2O9/c1-17(2,3)30-16(25)21-12(19(6,7)28-10)14(23)29-13(22)11(18(4,5)27-9)20-15(24)26-8/h11-12H,1-10H3,(H,20,24)(H,21,25) |
| InChIKey | NHUXEJPCEORYKF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|