C10H22ClN3O2 — CID 119320432
2-(4-aminobutanoylamino)-3,3-dimethylbutanamide;hydrochloride (PubChem CID 119320432) has the molecular formula C10H22ClN3O2 and a molecular weight of 251.76 g/mol. Its IUPAC name is 2-(4-aminobutanoylamino)-3,3-dimethylbutanamide;hydrochloride.
| Compound Name | 2-(4-aminobutanoylamino)-3,3-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119320432 |
| Molecular Formula | C10H22ClN3O2 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-(4-aminobutanoylamino)-3,3-dimethylbutanamide;hydrochloride |
| SMILES | CC(C)(C)C(NC(=O)CCCN)C(N)=O.Cl |
| InChI | InChI=1S/C10H21N3O2.ClH/c1-10(2,3)8(9(12)15)13-7(14)5-4-6-11;/h8H,4-6,11H2,1-3H3,(H2,12,15)(H,13,14);1H |
| InChIKey | YNHRXILFKGBINN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |