About 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide
2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide (PubChem CID 119778156) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide |
| PubChem CID | 119778156 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(NC(=O)CNCC1CC1)C(N)=O |
| InChI | InChI=1S/C12H23N3O2/c1-12(2,3)10(11(13)17)15-9(16)7-14-6-8-4-5-8/h8,10,14H,4-7H2,1-3H3,(H2,13,17)(H,15,16) |
| InChIKey | DBWYKMWWEFVCQZ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide?
The IUPAC name of 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide (CID 119778156) is 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide.
What is the SMILES notation for 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide?
The canonical SMILES for 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide is CC(C)(C)C(NC(=O)CNCC1CC1)C(N)=O.
What is the InChIKey of 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide?
The InChIKey is DBWYKMWWEFVCQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2/c1-12(2,3)10(11(13)17)15-9(16)7-14-6-8-4-5-8/h8,10,14H,4-7H2,1-3H3,(H2,13,17)(H,15,16).
What are the key properties of 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide?
2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide has a molecular weight of 241.33 g/mol, XLogP of 0.00, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(cyclopropylmethylamino)acetyl]amino]-3,3-dimethylbutanamide is sourced from PubChem (CID 119778156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).