C10H19ClN2O3 — CID 119781285
methyl (2R)-2-[[2-(cyclopropylmethylamino)acetyl]amino]propanoate;hydrochloride (PubChem CID 119781285) has the molecular formula C10H19ClN2O3 and a molecular weight of 250.73 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(cyclopropylmethylamino)acetyl]amino]propanoate;hydrochloride.
| Compound Name | methyl (2R)-2-[[2-(cyclopropylmethylamino)acetyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119781285 |
| Molecular Formula | C10H19ClN2O3 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | methyl (2R)-2-[[2-(cyclopropylmethylamino)acetyl]amino]propanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](C)NC(=O)CNCC1CC1.Cl |
| InChI | InChI=1S/C10H18N2O3.ClH/c1-7(10(14)15-2)12-9(13)6-11-5-8-3-4-8;/h7-8,11H,3-6H2,1-2H3,(H,12,13);1H/t7-;/m1./s1 |
| InChIKey | NAVVMFXBIVYAMC-OGFXRTJISA-N |
| XLogP | 0.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |