C11H18N2O4 — CID 126732205
tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxobut-3-yn-2-yl]carbamate (PubChem CID 126732205) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxobut-3-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxobut-3-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 126732205 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxobut-3-yn-2-yl]carbamate |
| SMILES | C#C[C@H](NC(=O)OC(C)(C)C)C(=O)N(C)OC |
| InChI | InChI=1S/C11H18N2O4/c1-7-8(9(14)13(5)16-6)12-10(15)17-11(2,3)4/h1,8H,2-6H3,(H,12,15)/t8-/m0/s1 |
| InChIKey | VICWSTGMNOSSAT-QMMMGPOBSA-N |
| XLogP | 0.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|