C12H20N2O8S2 — CID 20653696
methyl (2R)-2-(methoxycarbonylamino)-3-[[3-methoxy-2-(methoxycarbonylamino)-3-oxopropyl]disulfanyl]propanoate (PubChem CID 20653696) has the molecular formula C12H20N2O8S2 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl (2R)-2-(methoxycarbonylamino)-3-[[3-methoxy-2-(methoxycarbonylamino)-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | methyl (2R)-2-(methoxycarbonylamino)-3-[[3-methoxy-2-(methoxycarbonylamino)-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 20653696 |
| Molecular Formula | C12H20N2O8S2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | methyl (2R)-2-(methoxycarbonylamino)-3-[[3-methoxy-2-(methoxycarbonylamino)-3-oxopropyl]disulfanyl]propanoate |
| SMILES | COC(=O)NC(CSSC[C@H](NC(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H20N2O8S2/c1-19-9(15)7(13-11(17)21-3)5-23-24-6-8(10(16)20-2)14-12(18)22-4/h7-8H,5-6H2,1-4H3,(H,13,17)(H,14,18)/t7-,8?/m0/s1 |
| InChIKey | QXRUSXVGIOEWBT-JAMMHHFISA-N |
| XLogP | 0.16 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|