C7H12ClNO4 — CID 175350926
methyl 4-chloro-2-(methoxycarbonylamino)butanoate (PubChem CID 175350926) has the molecular formula C7H12ClNO4 and a molecular weight of 209.63 g/mol. Its IUPAC name is methyl 4-chloro-2-(methoxycarbonylamino)butanoate.
| Compound Name | methyl 4-chloro-2-(methoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 175350926 |
| Molecular Formula | C7H12ClNO4 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | methyl 4-chloro-2-(methoxycarbonylamino)butanoate |
| SMILES | COC(=O)NC(CCCl)C(=O)OC |
| InChI | InChI=1S/C7H12ClNO4/c1-12-6(10)5(3-4-8)9-7(11)13-2/h5H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | FVDHBBYFMBIEOO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|