C12H24Cl2N4O6S2 — CID 57341762
methyl (2R)-2-[(2-aminoacetyl)amino]-3-[[(2R)-2-[(2-aminoacetyl)amino]-3-methoxy-3-oxopropyl]disulfanyl]propanoate;dihydrochloride (PubChem CID 57341762) has the molecular formula C12H24Cl2N4O6S2 and a molecular weight of 455.39 g/mol. Its IUPAC name is methyl (2R)-2-[(2-aminoacetyl)amino]-3-[[(2R)-2-[(2-aminoacetyl)amino]-3-methoxy-3-oxopropyl]disulfanyl]propanoate;dihydrochloride.
| Compound Name | methyl (2R)-2-[(2-aminoacetyl)amino]-3-[[(2R)-2-[(2-aminoacetyl)amino]-3-methoxy-3-oxopropyl]disulfanyl]propanoate;dihydrochloride |
|---|---|
| PubChem CID | 57341762 |
| Molecular Formula | C12H24Cl2N4O6S2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | methyl (2R)-2-[(2-aminoacetyl)amino]-3-[[(2R)-2-[(2-aminoacetyl)amino]-3-methoxy-3-oxopropyl]disulfanyl]propanoate;dihydrochloride |
| SMILES | COC(=O)[C@H](CSSC[C@H](NC(=O)CN)C(=O)OC)NC(=O)CN.Cl.Cl |
| InChI | InChI=1S/C12H22N4O6S2.2ClH/c1-21-11(19)7(15-9(17)3-13)5-23-24-6-8(12(20)22-2)16-10(18)4-14;;/h7-8H,3-6,13-14H2,1-2H3,(H,15,17)(H,16,18);2*1H/t7-,8-;;/m0../s1 |
| InChIKey | MWVYBDDIDQSWCD-FOMWZSOGSA-N |
| XLogP | -1.56 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|