C24H28N4O8S2 — CID 11017566
CID 11017566 (PubChem CID 11017566) has the molecular formula C24H28N4O8S2 and a molecular weight of 564.64 g/mol.
| Compound Name | CID 11017566 |
|---|---|
| PubChem CID | 11017566 |
| Molecular Formula | C24H28N4O8S2 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H](CSSC[C@H](NC(=O)CNC(=O)[C]1[CH][CH][CH][CH]1)C(=O)OC)NC(=O)CNC(=O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C24H28N4O8S2/c1-35-23(33)17(27-19(29)11-25-21(31)15-7-3-4-8-15)13-37-38-14-18(24(34)36-2)28-20(30)12-26-22(32)16-9-5-6-10-16/h3-10,17-18H,11-14H2,1-2H3,(H,25,31)(H,26,32)(H,27,29)(H,28,30)/t17-,18-/m0/s1 |
| InChIKey | OWKIEAVGXKVUOE-ROUUACIJSA-N |
| XLogP | -1.27 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|