C14H24N6O8S2 — CID 101431726
(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-[[(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-carboxyethyl]disulfanyl]propanoic acid (PubChem CID 101431726) has the molecular formula C14H24N6O8S2 and a molecular weight of 468.51 g/mol. Its IUPAC name is (2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-[[(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-carboxyethyl]disulfanyl]propanoic acid.
| Compound Name | (2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-[[(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-carboxyethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 101431726 |
| Molecular Formula | C14H24N6O8S2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-[[(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-carboxyethyl]disulfanyl]propanoic acid |
| SMILES | NCC(=O)NCC(=O)N[C@@H](CSSC[C@H](NC(=O)CNC(=O)CN)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H24N6O8S2/c15-1-9(21)17-3-11(23)19-7(13(25)26)5-29-30-6-8(14(27)28)20-12(24)4-18-10(22)2-16/h7-8H,1-6,15-16H2,(H,17,21)(H,18,22)(H,19,23)(H,20,24)(H,25,26)(H,27,28)/t7-,8-/m0/s1 |
| InChIKey | UTKBPTSBPAWZOJ-YUMQZZPRSA-N |
| XLogP | -4.34 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|