C12H25N5O6P2S2 — CID 87433856
2-amino-3-[[(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-ethoxy-3-oxopropyl]disulfanyl]propanoic acid;diphosphazene (PubChem CID 87433856) has the molecular formula C12H25N5O6P2S2 and a molecular weight of 461.44 g/mol. Its IUPAC name is 2-amino-3-[[(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-ethoxy-3-oxopropyl]disulfanyl]propanoic acid;diphosphazene.
| Compound Name | 2-amino-3-[[(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-ethoxy-3-oxopropyl]disulfanyl]propanoic acid;diphosphazene |
|---|---|
| PubChem CID | 87433856 |
| Molecular Formula | C12H25N5O6P2S2 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 2-amino-3-[[(2R)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-ethoxy-3-oxopropyl]disulfanyl]propanoic acid;diphosphazene |
| SMILES | CCOC(=O)[C@H](CSSCC(N)C(=O)O)NC(=O)CNC(=O)CN.[H]/P=N/P |
| InChI | InChI=1S/C12H22N4O6S2.H3NP2/c1-2-22-12(21)8(6-24-23-5-7(14)11(19)20)16-10(18)4-15-9(17)3-13;2-1-3/h7-8H,2-6,13-14H2,1H3,(H,15,17)(H,16,18)(H,19,20);2H,3H2/t7?,8-;/m0./s1 |
| InChIKey | PLFODKDKQWHDLC-MTICXXPYSA-N |
| XLogP | -0.99 |
| TPSA | 186.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|