C20H32N2O8S2 — CID 53379536
methyl 3-[[3-methoxy-2-[(4-methyl-2-oxopentanoyl)amino]-3-oxopropyl]disulfanyl]-2-[(4-methyl-2-oxopentanoyl)amino]propanoate (PubChem CID 53379536) has the molecular formula C20H32N2O8S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is methyl 3-[[3-methoxy-2-[(4-methyl-2-oxopentanoyl)amino]-3-oxopropyl]disulfanyl]-2-[(4-methyl-2-oxopentanoyl)amino]propanoate.
| Compound Name | methyl 3-[[3-methoxy-2-[(4-methyl-2-oxopentanoyl)amino]-3-oxopropyl]disulfanyl]-2-[(4-methyl-2-oxopentanoyl)amino]propanoate |
|---|---|
| PubChem CID | 53379536 |
| Molecular Formula | C20H32N2O8S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | methyl 3-[[3-methoxy-2-[(4-methyl-2-oxopentanoyl)amino]-3-oxopropyl]disulfanyl]-2-[(4-methyl-2-oxopentanoyl)amino]propanoate |
| SMILES | COC(=O)C(CSSCC(NC(=O)C(=O)CC(C)C)C(=O)OC)NC(=O)C(=O)CC(C)C |
| InChI | InChI=1S/C20H32N2O8S2/c1-11(2)7-15(23)17(25)21-13(19(27)29-5)9-31-32-10-14(20(28)30-6)22-18(26)16(24)8-12(3)4/h11-14H,7-10H2,1-6H3,(H,21,25)(H,22,26) |
| InChIKey | OVBFXBRVQSEROA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|