C16H28N2O8S2 — CID 90381122
propan-2-yl (2R)-2-(methoxycarbonylamino)-3-[[(2R)-2-(methoxycarbonylamino)-3-oxo-3-propan-2-yloxypropyl]disulfanyl]propanoate (PubChem CID 90381122) has the molecular formula C16H28N2O8S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is propan-2-yl (2R)-2-(methoxycarbonylamino)-3-[[(2R)-2-(methoxycarbonylamino)-3-oxo-3-propan-2-yloxypropyl]disulfanyl]propanoate.
| Compound Name | propan-2-yl (2R)-2-(methoxycarbonylamino)-3-[[(2R)-2-(methoxycarbonylamino)-3-oxo-3-propan-2-yloxypropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 90381122 |
| Molecular Formula | C16H28N2O8S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | propan-2-yl (2R)-2-(methoxycarbonylamino)-3-[[(2R)-2-(methoxycarbonylamino)-3-oxo-3-propan-2-yloxypropyl]disulfanyl]propanoate |
| SMILES | COC(=O)N[C@@H](CSSC[C@H](NC(=O)OC)C(=O)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C16H28N2O8S2/c1-9(2)25-13(19)11(17-15(21)23-5)7-27-28-8-12(18-16(22)24-6)14(20)26-10(3)4/h9-12H,7-8H2,1-6H3,(H,17,21)(H,18,22)/t11-,12-/m0/s1 |
| InChIKey | CAKOZFDAQWUWMC-RYUDHWBXSA-N |
| XLogP | 1.72 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|