C8H16N2O4 — CID 87499575
methyl (2S)-3-amino-2-(propan-2-yloxycarbonylamino)propanoate (PubChem CID 87499575) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is methyl (2S)-3-amino-2-(propan-2-yloxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-amino-2-(propan-2-yloxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 87499575 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | methyl (2S)-3-amino-2-(propan-2-yloxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@H](CN)NC(=O)OC(C)C |
| InChI | InChI=1S/C8H16N2O4/c1-5(2)14-8(12)10-6(4-9)7(11)13-3/h5-6H,4,9H2,1-3H3,(H,10,12)/t6-/m0/s1 |
| InChIKey | PDTQGZBMEZVLRF-LURJTMIESA-N |
| XLogP | -0.38 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |