C8H16N2O3 — CID 116657976
propan-2-yl N-(4-amino-4-oxobutan-2-yl)carbamate (PubChem CID 116657976) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is propan-2-yl N-(4-amino-4-oxobutan-2-yl)carbamate.
| Compound Name | propan-2-yl N-(4-amino-4-oxobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 116657976 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | propan-2-yl N-(4-amino-4-oxobutan-2-yl)carbamate |
| SMILES | CC(CC(N)=O)NC(=O)OC(C)C |
| InChI | InChI=1S/C8H16N2O3/c1-5(2)13-8(12)10-6(3)4-7(9)11/h5-6H,4H2,1-3H3,(H2,9,11)(H,10,12) |
| InChIKey | KAIDVDFFKGSLIV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |