C6H13N3OS — CID 116510284
3-(methylcarbamothioylamino)butanamide (PubChem CID 116510284) has the molecular formula C6H13N3OS and a molecular weight of 175.26 g/mol. Its IUPAC name is 3-(methylcarbamothioylamino)butanamide.
| Compound Name | 3-(methylcarbamothioylamino)butanamide |
|---|---|
| PubChem CID | 116510284 |
| Molecular Formula | C6H13N3OS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 3-(methylcarbamothioylamino)butanamide |
| SMILES | CNC(=S)NC(C)CC(N)=O |
| InChI | InChI=1S/C6H13N3OS/c1-4(3-5(7)10)9-6(11)8-2/h4H,3H2,1-2H3,(H2,7,10)(H2,8,9,11) |
| InChIKey | ASFJNLCYUIXDLJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|