C9H18N2O3 — CID 103711750
3-[(2-propoxyacetyl)amino]butanamide (PubChem CID 103711750) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-[(2-propoxyacetyl)amino]butanamide.
| Compound Name | 3-[(2-propoxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 103711750 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 3-[(2-propoxyacetyl)amino]butanamide |
| SMILES | CCCOCC(=O)NC(C)CC(N)=O |
| InChI | InChI=1S/C9H18N2O3/c1-3-4-14-6-9(13)11-7(2)5-8(10)12/h7H,3-6H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | FSQMBOUOIPTAND-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|