C9H17NO5 — CID 104701957
methyl 3-hydroxy-2-[(2-propoxyacetyl)amino]propanoate (PubChem CID 104701957) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[(2-propoxyacetyl)amino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[(2-propoxyacetyl)amino]propanoate |
|---|---|
| PubChem CID | 104701957 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | methyl 3-hydroxy-2-[(2-propoxyacetyl)amino]propanoate |
| SMILES | CCCOCC(=O)NC(CO)C(=O)OC |
| InChI | InChI=1S/C9H17NO5/c1-3-4-15-6-8(12)10-7(5-11)9(13)14-2/h7,11H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | YJVXEAHQKRARMN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|