C8H19N3O3S2 — CID 88735839
carbamothioic S-acid;O-methyl carbamothioate;N-propan-2-ylacetamide (PubChem CID 88735839) has the molecular formula C8H19N3O3S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is carbamothioic S-acid;O-methyl carbamothioate;N-propan-2-ylacetamide.
| Compound Name | carbamothioic S-acid;O-methyl carbamothioate;N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 88735839 |
| Molecular Formula | C8H19N3O3S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | carbamothioic S-acid;O-methyl carbamothioate;N-propan-2-ylacetamide |
| SMILES | CC(=O)NC(C)C.COC(N)=S.NC(=O)S |
| InChI | InChI=1S/C5H11NO.C2H5NOS.CH3NOS/c1-4(2)6-5(3)7;1-4-2(3)5;2-1(3)4/h4H,1-3H3,(H,6,7);1H3,(H2,3,5);(H3,2,3,4) |
| InChIKey | NMHNJKKLKJLYSR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|