C8H14N2O9 — CID 174878339
2,3-dihydroxybutanedioic acid;N'-hydroxybutanediamide (PubChem CID 174878339) has the molecular formula C8H14N2O9 and a molecular weight of 282.21 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;N'-hydroxybutanediamide.
| Compound Name | 2,3-dihydroxybutanedioic acid;N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 174878339 |
| Molecular Formula | C8H14N2O9 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;N'-hydroxybutanediamide |
| SMILES | NC(=O)CCC(=O)NO.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C4H8N2O3.C4H6O6/c5-3(7)1-2-4(8)6-9;5-1(3(7)8)2(6)4(9)10/h9H,1-2H2,(H2,5,7)(H,6,8);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | OIRPGVAOHSJJAC-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 207.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|